C19H18N4O5 — CID 34064325
(4R)-6-methyl-N-(4-nitrophenyl)-2-oxo-4-phenylmethoxy-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 34064325) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is (4R)-6-methyl-N-(4-nitrophenyl)-2-oxo-4-phenylmethoxy-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4R)-6-methyl-N-(4-nitrophenyl)-2-oxo-4-phenylmethoxy-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 34064325 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (4R)-6-methyl-N-(4-nitrophenyl)-2-oxo-4-phenylmethoxy-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc([N+](=O)[O-])cc2)[C@@H](OCc2ccccc2)NC(=O)N1 |
| InChI | InChI=1S/C19H18N4O5/c1-12-16(17(24)21-14-7-9-15(10-8-14)23(26)27)18(22-19(25)20-12)28-11-13-5-3-2-4-6-13/h2-10,18H,11H2,1H3,(H,21,24)(H2,20,22,25)/t18-/m1/s1 |
| InChIKey | ZWNQUFXAZQEDCP-GOSISDBHSA-N |
| XLogP | 2.66 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|