C9H5Cl2F3N4 — CID 3410226
[6,7-dichloro-3-(trifluoromethyl)quinoxalin-2-yl]hydrazine (PubChem CID 3410226) has the molecular formula C9H5Cl2F3N4 and a molecular weight of 297.07 g/mol. Its IUPAC name is [6,7-dichloro-3-(trifluoromethyl)quinoxalin-2-yl]hydrazine.
| Compound Name | [6,7-dichloro-3-(trifluoromethyl)quinoxalin-2-yl]hydrazine |
|---|---|
| PubChem CID | 3410226 |
| Molecular Formula | C9H5Cl2F3N4 |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | [6,7-dichloro-3-(trifluoromethyl)quinoxalin-2-yl]hydrazine |
| SMILES | NNc1nc2cc(Cl)c(Cl)cc2nc1C(F)(F)F |
| InChI | InChI=1S/C9H5Cl2F3N4/c10-3-1-5-6(2-4(3)11)17-8(18-15)7(16-5)9(12,13)14/h1-2H,15H2,(H,17,18) |
| InChIKey | CIJPLIXNNSXNQE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|