C13H7F12N3O3 — CID 3412012
3,3,3-trifluoro-N-[1,1,1,3,3,3-hexafluoro-2-(3-nitroanilino)propan-2-yl]-2-(trifluoromethyl)propanamide (PubChem CID 3412012) has the molecular formula C13H7F12N3O3 and a molecular weight of 481.19 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[1,1,1,3,3,3-hexafluoro-2-(3-nitroanilino)propan-2-yl]-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-N-[1,1,1,3,3,3-hexafluoro-2-(3-nitroanilino)propan-2-yl]-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 3412012 |
| Molecular Formula | C13H7F12N3O3 |
| Molecular Weight | 481.19 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 3,3,3-trifluoro-N-[1,1,1,3,3,3-hexafluoro-2-(3-nitroanilino)propan-2-yl]-2-(trifluoromethyl)propanamide |
| SMILES | O=C(NC(Nc1cccc([N+](=O)[O-])c1)(C(F)(F)F)C(F)(F)F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H7F12N3O3/c14-9(15,16)7(10(17,18)19)8(29)27-11(12(20,21)22,13(23,24)25)26-5-2-1-3-6(4-5)28(30)31/h1-4,7,26H,(H,27,29) |
| InChIKey | RWYXBOIOBWXACR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.19 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|