C17H15F2N3O2 — CID 3415037
1-(1-acetyl-2,3-dihydroindol-7-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 3415037) has the molecular formula C17H15F2N3O2 and a molecular weight of 331.32 g/mol. Its IUPAC name is 1-(1-acetyl-2,3-dihydroindol-7-yl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(1-acetyl-2,3-dihydroindol-7-yl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 3415037 |
| Molecular Formula | C17H15F2N3O2 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 1-(1-acetyl-2,3-dihydroindol-7-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | CC(=O)N1CCc2cccc(NC(=O)Nc3ccc(F)cc3F)c21 |
| InChI | InChI=1S/C17H15F2N3O2/c1-10(23)22-8-7-11-3-2-4-15(16(11)22)21-17(24)20-14-6-5-12(18)9-13(14)19/h2-6,9H,7-8H2,1H3,(H2,20,21,24) |
| InChIKey | RTOZFUZWMGRJBZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |