C17H21F2N3O3 — CID 108961299
3-(4-acetylpiperazin-1-yl)-N-(2,4-difluorophenyl)-2,2-dimethyl-3-oxopropanamide (PubChem CID 108961299) has the molecular formula C17H21F2N3O3 and a molecular weight of 353.37 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)-N-(2,4-difluorophenyl)-2,2-dimethyl-3-oxopropanamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)-N-(2,4-difluorophenyl)-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108961299 |
| Molecular Formula | C17H21F2N3O3 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)-N-(2,4-difluorophenyl)-2,2-dimethyl-3-oxopropanamide |
| SMILES | CC(=O)N1CCN(C(=O)C(C)(C)C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C17H21F2N3O3/c1-11(23)21-6-8-22(9-7-21)16(25)17(2,3)15(24)20-14-5-4-12(18)10-13(14)19/h4-5,10H,6-9H2,1-3H3,(H,20,24) |
| InChIKey | YJUFREGYUCXORL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|