C11H18N2 — CID 3415764
2-N,2-N-dimethyl-3-phenylpropane-1,2-diamine (PubChem CID 3415764) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-3-phenylpropane-1,2-diamine.
| Compound Name | 2-N,2-N-dimethyl-3-phenylpropane-1,2-diamine |
|---|---|
| PubChem CID | 3415764 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-N,2-N-dimethyl-3-phenylpropane-1,2-diamine |
| SMILES | CN(C)C(CN)Cc1ccccc1 |
| InChI | InChI=1S/C11H18N2/c1-13(2)11(9-12)8-10-6-4-3-5-7-10/h3-7,11H,8-9,12H2,1-2H3 |
| InChIKey | UNKNAPRNXOMOJQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |