C27H28ClN3O5S — CID 3416173
ethyl 2-[[2-[4-(4-tert-butylphenyl)sulfonyloxyphenyl]-6-chloroimidazo[1,2-a]pyridin-3-yl]amino]acetate (PubChem CID 3416173) has the molecular formula C27H28ClN3O5S and a molecular weight of 542.06 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(4-tert-butylphenyl)sulfonyloxyphenyl]-6-chloroimidazo[1,2-a]pyridin-3-yl]amino]acetate.
| Compound Name | ethyl 2-[[2-[4-(4-tert-butylphenyl)sulfonyloxyphenyl]-6-chloroimidazo[1,2-a]pyridin-3-yl]amino]acetate |
|---|---|
| PubChem CID | 3416173 |
| Molecular Formula | C27H28ClN3O5S |
| Molecular Weight | 542.06 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | ethyl 2-[[2-[4-(4-tert-butylphenyl)sulfonyloxyphenyl]-6-chloroimidazo[1,2-a]pyridin-3-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1c(-c2ccc(OS(=O)(=O)c3ccc(C(C)(C)C)cc3)cc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C27H28ClN3O5S/c1-5-35-24(32)16-29-26-25(30-23-15-10-20(28)17-31(23)26)18-6-11-21(12-7-18)36-37(33,34)22-13-8-19(9-14-22)27(2,3)4/h6-15,17,29H,5,16H2,1-4H3 |
| InChIKey | WVEGWHXRZKTZSJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.06 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|