C24H21Cl2N3O5S — CID 42742915
ethyl 2-[[2-[4-(2,5-dichlorophenyl)sulfonyloxyphenyl]-6-methylimidazo[1,2-a]pyridin-3-yl]amino]acetate (PubChem CID 42742915) has the molecular formula C24H21Cl2N3O5S and a molecular weight of 534.42 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(2,5-dichlorophenyl)sulfonyloxyphenyl]-6-methylimidazo[1,2-a]pyridin-3-yl]amino]acetate.
| Compound Name | ethyl 2-[[2-[4-(2,5-dichlorophenyl)sulfonyloxyphenyl]-6-methylimidazo[1,2-a]pyridin-3-yl]amino]acetate |
|---|---|
| PubChem CID | 42742915 |
| Molecular Formula | C24H21Cl2N3O5S |
| Molecular Weight | 534.42 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | ethyl 2-[[2-[4-(2,5-dichlorophenyl)sulfonyloxyphenyl]-6-methylimidazo[1,2-a]pyridin-3-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1c(-c2ccc(OS(=O)(=O)c3cc(Cl)ccc3Cl)cc2)nc2ccc(C)cn12 |
| InChI | InChI=1S/C24H21Cl2N3O5S/c1-3-33-22(30)13-27-24-23(28-21-11-4-15(2)14-29(21)24)16-5-8-18(9-6-16)34-35(31,32)20-12-17(25)7-10-19(20)26/h4-12,14,27H,3,13H2,1-2H3 |
| InChIKey | VBLSFUZLBDYEEX-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|