C23H18ClN5O9S — CID 3948671
ethyl 2-[[6-chloro-2-[3-(2,4-dinitrophenyl)sulfonyloxyphenyl]imidazo[1,2-a]pyridin-3-yl]amino]acetate (PubChem CID 3948671) has the molecular formula C23H18ClN5O9S and a molecular weight of 575.94 g/mol. Its IUPAC name is ethyl 2-[[6-chloro-2-[3-(2,4-dinitrophenyl)sulfonyloxyphenyl]imidazo[1,2-a]pyridin-3-yl]amino]acetate.
| Compound Name | ethyl 2-[[6-chloro-2-[3-(2,4-dinitrophenyl)sulfonyloxyphenyl]imidazo[1,2-a]pyridin-3-yl]amino]acetate |
|---|---|
| PubChem CID | 3948671 |
| Molecular Formula | C23H18ClN5O9S |
| Molecular Weight | 575.94 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | ethyl 2-[[6-chloro-2-[3-(2,4-dinitrophenyl)sulfonyloxyphenyl]imidazo[1,2-a]pyridin-3-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1c(-c2cccc(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C23H18ClN5O9S/c1-2-37-21(30)12-25-23-22(26-20-9-6-15(24)13-27(20)23)14-4-3-5-17(10-14)38-39(35,36)19-8-7-16(28(31)32)11-18(19)29(33)34/h3-11,13,25H,2,12H2,1H3 |
| InChIKey | SOCZELQYYYZWDU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 185.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.94 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|