C26H26N4O6S — CID 5111231
ethyl 2-[[2-[3-(4-acetamidophenyl)sulfonyloxyphenyl]-5-methylimidazo[1,2-a]pyridin-3-yl]amino]acetate (PubChem CID 5111231) has the molecular formula C26H26N4O6S and a molecular weight of 522.58 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(4-acetamidophenyl)sulfonyloxyphenyl]-5-methylimidazo[1,2-a]pyridin-3-yl]amino]acetate.
| Compound Name | ethyl 2-[[2-[3-(4-acetamidophenyl)sulfonyloxyphenyl]-5-methylimidazo[1,2-a]pyridin-3-yl]amino]acetate |
|---|---|
| PubChem CID | 5111231 |
| Molecular Formula | C26H26N4O6S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | ethyl 2-[[2-[3-(4-acetamidophenyl)sulfonyloxyphenyl]-5-methylimidazo[1,2-a]pyridin-3-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1c(-c2cccc(OS(=O)(=O)c3ccc(NC(C)=O)cc3)c2)nc2cccc(C)n12 |
| InChI | InChI=1S/C26H26N4O6S/c1-4-35-24(32)16-27-26-25(29-23-10-5-7-17(2)30(23)26)19-8-6-9-21(15-19)36-37(33,34)22-13-11-20(12-14-22)28-18(3)31/h5-15,27H,4,16H2,1-3H3,(H,28,31) |
| InChIKey | UAVSAMHJRXVWFM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|