C25H26ClN3O6S2 — CID 3419129
4-chloro-N-(3-methoxypropyl)-3-nitro-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]benzenesulfonamide (PubChem CID 3419129) has the molecular formula C25H26ClN3O6S2 and a molecular weight of 564.09 g/mol. Its IUPAC name is 4-chloro-N-(3-methoxypropyl)-3-nitro-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-(3-methoxypropyl)-3-nitro-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3419129 |
| Molecular Formula | C25H26ClN3O6S2 |
| Molecular Weight | 564.09 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | 4-chloro-N-(3-methoxypropyl)-3-nitro-N-[2-oxo-2-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)ethyl]benzenesulfonamide |
| SMILES | COCCCN(CC(=O)N1CCc2sccc2C1c1ccccc1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26ClN3O6S2/c1-35-14-5-12-27(37(33,34)19-8-9-21(26)22(16-19)29(31)32)17-24(30)28-13-10-23-20(11-15-36-23)25(28)18-6-3-2-4-7-18/h2-4,6-9,11,15-16,25H,5,10,12-14,17H2,1H3 |
| InChIKey | ZWHRNIBGYREFDA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.09 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|