C25H26ClN3O5S2 — CID 98415349
4-chloro-N-[2-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzenesulfonamide (PubChem CID 98415349) has the molecular formula C25H26ClN3O5S2 and a molecular weight of 548.09 g/mol. Its IUPAC name is 4-chloro-N-[2-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[2-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 98415349 |
| Molecular Formula | C25H26ClN3O5S2 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | 4-chloro-N-[2-[(4R)-4-(2-methylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitro-N-propan-2-ylbenzenesulfonamide |
| SMILES | Cc1ccccc1[C@@H]1c2ccsc2CCN1C(=O)CN(C(C)C)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26ClN3O5S2/c1-16(2)28(36(33,34)18-8-9-21(26)22(14-18)29(31)32)15-24(30)27-12-10-23-20(11-13-35-23)25(27)19-7-5-4-6-17(19)3/h4-9,11,13-14,16,25H,10,12,15H2,1-3H3/t25-/m1/s1 |
| InChIKey | NEPNFDPMOMFBTK-RUZDIDTESA-N |
| XLogP | 5.19 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|