C29H34ClN3O5S2 — CID 42776316
N-[2-[4-(4-tert-butylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-chloro-N-(2-methylpropyl)-3-nitrobenzenesulfonamide (PubChem CID 42776316) has the molecular formula C29H34ClN3O5S2 and a molecular weight of 604.19 g/mol. Its IUPAC name is N-[2-[4-(4-tert-butylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-chloro-N-(2-methylpropyl)-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[4-(4-tert-butylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-chloro-N-(2-methylpropyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 42776316 |
| Molecular Formula | C29H34ClN3O5S2 |
| Molecular Weight | 604.19 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | N-[2-[4-(4-tert-butylphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-4-chloro-N-(2-methylpropyl)-3-nitrobenzenesulfonamide |
| SMILES | CC(C)CN(CC(=O)N1CCc2sccc2C1c1ccc(C(C)(C)C)cc1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H34ClN3O5S2/c1-19(2)17-31(40(37,38)22-10-11-24(30)25(16-22)33(35)36)18-27(34)32-14-12-26-23(13-15-39-26)28(32)20-6-8-21(9-7-20)29(3,4)5/h6-11,13,15-16,19,28H,12,14,17-18H2,1-5H3 |
| InChIKey | YOINRSIYJZVUOR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.19 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|