C26H28ClN3O6S2 — CID 4637330
N-butan-2-yl-4-chloro-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitrobenzenesulfonamide (PubChem CID 4637330) has the molecular formula C26H28ClN3O6S2 and a molecular weight of 578.11 g/mol. Its IUPAC name is N-butan-2-yl-4-chloro-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-butan-2-yl-4-chloro-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 4637330 |
| Molecular Formula | C26H28ClN3O6S2 |
| Molecular Weight | 578.11 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | N-butan-2-yl-4-chloro-N-[2-[4-(4-methoxyphenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-2-oxoethyl]-3-nitrobenzenesulfonamide |
| SMILES | CCC(C)N(CC(=O)N1CCc2sccc2C1c1ccc(OC)cc1)S(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H28ClN3O6S2/c1-4-17(2)29(38(34,35)20-9-10-22(27)23(15-20)30(32)33)16-25(31)28-13-11-24-21(12-14-37-24)26(28)18-5-7-19(36-3)8-6-18/h5-10,12,14-15,17,26H,4,11,13,16H2,1-3H3 |
| InChIKey | NHLUTZFXXWNDAP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.11 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|