C14H18F3NO — CID 3419824
1-(1-ethenyl-5-methyl-4-pentylpyrrol-2-yl)-2,2,2-trifluoroethanone (PubChem CID 3419824) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-(1-ethenyl-5-methyl-4-pentylpyrrol-2-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1-ethenyl-5-methyl-4-pentylpyrrol-2-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 3419824 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-(1-ethenyl-5-methyl-4-pentylpyrrol-2-yl)-2,2,2-trifluoroethanone |
| SMILES | C=Cn1c(C(=O)C(F)(F)F)cc(CCCCC)c1C |
| InChI | InChI=1S/C14H18F3NO/c1-4-6-7-8-11-9-12(13(19)14(15,16)17)18(5-2)10(11)3/h5,9H,2,4,6-8H2,1,3H3 |
| InChIKey | WHOJQORWALFWID-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|