C19H26F3NO2 — CID 25100235
2-nitro-1,3-dipentyl-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene (PubChem CID 25100235) has the molecular formula C19H26F3NO2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 2-nitro-1,3-dipentyl-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene.
| Compound Name | 2-nitro-1,3-dipentyl-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 25100235 |
| Molecular Formula | C19H26F3NO2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-nitro-1,3-dipentyl-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
| SMILES | C=C(c1cc(CCCCC)c([N+](=O)[O-])c(CCCCC)c1)C(F)(F)F |
| InChI | InChI=1S/C19H26F3NO2/c1-4-6-8-10-15-12-17(14(3)19(20,21)22)13-16(11-9-7-5-2)18(15)23(24)25/h12-13H,3-11H2,1-2H3 |
| InChIKey | NCMFMHVAAHVPKH-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|