C22H27N5O — CID 34275196
4-(4-benzylpiperazin-1-yl)-N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]aniline (PubChem CID 34275196) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]aniline.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]aniline |
|---|---|
| PubChem CID | 34275196 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-N-[(1S)-1-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]aniline |
| SMILES | Cc1noc([C@H](C)Nc2ccc(N3CCN(Cc4ccccc4)CC3)cc2)n1 |
| InChI | InChI=1S/C22H27N5O/c1-17(22-24-18(2)25-28-22)23-20-8-10-21(11-9-20)27-14-12-26(13-15-27)16-19-6-4-3-5-7-19/h3-11,17,23H,12-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | VPXAZXCHBDZBKD-KRWDZBQOSA-N |
| XLogP | 3.87 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|