C21H17BrN4O4 — CID 3427564
[4-bromo-2-[(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate (PubChem CID 3427564) has the molecular formula C21H17BrN4O4 and a molecular weight of 469.30 g/mol. Its IUPAC name is [4-bromo-2-[(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [4-bromo-2-[(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 3427564 |
| Molecular Formula | C21H17BrN4O4 |
| Molecular Weight | 469.30 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | [4-bromo-2-[(pyrazine-2-carbonylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(Br)cc2C=NNC(=O)c2cnccn2)cc1 |
| InChI | InChI=1S/C21H17BrN4O4/c1-2-29-17-6-3-14(4-7-17)21(28)30-19-8-5-16(22)11-15(19)12-25-26-20(27)18-13-23-9-10-24-18/h3-13H,2H2,1H3,(H,26,27) |
| InChIKey | TYDDGVPTLYVLQJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|