C26H18BrFN2O5S — CID 3427806
5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 3427806) has the molecular formula C26H18BrFN2O5S and a molecular weight of 569.41 g/mol. Its IUPAC name is 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3427806 |
| Molecular Formula | C26H18BrFN2O5S |
| Molecular Weight | 569.41 g/mol |
| Exact Mass | 568.01 |
| IUPAC Name | 5-(3-bromo-4-hydroxy-5-methoxyphenyl)-1-(6-fluoro-1,3-benzothiazol-2-yl)-4-[hydroxy-(4-methylphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3ccc(C)cc3)C(=O)C(=O)N2c2nc3ccc(F)cc3s2)cc(Br)c1O |
| InChI | InChI=1S/C26H18BrFN2O5S/c1-12-3-5-13(6-4-12)22(31)20-21(14-9-16(27)23(32)18(10-14)35-2)30(25(34)24(20)33)26-29-17-8-7-15(28)11-19(17)36-26/h3-11,21,31-32H,1-2H3 |
| InChIKey | RYVILBAOPQXQMF-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|