C12H15BrN2O2 — CID 3430311
4-bromo-1-N,2-N-bis(oxiran-2-ylmethyl)benzene-1,2-diamine (PubChem CID 3430311) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 4-bromo-1-N,2-N-bis(oxiran-2-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N,2-N-bis(oxiran-2-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 3430311 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 4-bromo-1-N,2-N-bis(oxiran-2-ylmethyl)benzene-1,2-diamine |
| SMILES | Brc1ccc(NCC2CO2)c(NCC2CO2)c1 |
| InChI | InChI=1S/C12H15BrN2O2/c13-8-1-2-11(14-4-9-6-16-9)12(3-8)15-5-10-7-17-10/h1-3,9-10,14-15H,4-7H2 |
| InChIKey | OVKWFGZLYWMSHW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|