About 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine
1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine (PubChem CID 19376084) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine |
| PubChem CID | 19376084 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine |
| SMILES | c1cc(NCC2CO2)ccc1NCC1CO1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-10(14-6-12-8-16-12)4-3-9(1)13-5-11-7-15-11/h1-4,11-14H,5-8H2 |
| InChIKey | MOCGIUSFMCCBTP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine?
The IUPAC name of 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine (CID 19376084) is 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine.
What is the SMILES notation for 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine?
The canonical SMILES for 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine is c1cc(NCC2CO2)ccc1NCC1CO1.
What is the InChIKey of 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine?
The InChIKey is MOCGIUSFMCCBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-2-10(14-6-12-8-16-12)4-3-9(1)13-5-11-7-15-11/h1-4,11-14H,5-8H2.
What are the key properties of 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine?
1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine has a molecular weight of 220.27 g/mol, XLogP of 1.31, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine is sourced from PubChem (CID 19376084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).