C12H16N2O2 — CID 19376084
1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine (PubChem CID 19376084) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 19376084 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-N,4-N-bis(oxiran-2-ylmethyl)benzene-1,4-diamine |
| SMILES | c1cc(NCC2CO2)ccc1NCC1CO1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-10(14-6-12-8-16-12)4-3-9(1)13-5-11-7-15-11/h1-4,11-14H,5-8H2 |
| InChIKey | MOCGIUSFMCCBTP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 49.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|