C11H14INO2 — CID 81102544
N-(1,3-dioxan-4-ylmethyl)-4-iodoaniline (PubChem CID 81102544) has the molecular formula C11H14INO2 and a molecular weight of 319.14 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-4-iodoaniline.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-4-iodoaniline |
|---|---|
| PubChem CID | 81102544 |
| Molecular Formula | C11H14INO2 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-4-iodoaniline |
| SMILES | Ic1ccc(NCC2CCOCO2)cc1 |
| InChI | InChI=1S/C11H14INO2/c12-9-1-3-10(4-2-9)13-7-11-5-6-14-8-15-11/h1-4,11,13H,5-8H2 |
| InChIKey | AHHQHPYJLJJHHW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|