C11H13ClFNO2 — CID 104952400
3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline (PubChem CID 104952400) has the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. Its IUPAC name is 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline.
| Compound Name | 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline |
|---|---|
| PubChem CID | 104952400 |
| Molecular Formula | C11H13ClFNO2 |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline |
| SMILES | Fc1cc(Cl)cc(NCC2CCOCO2)c1 |
| InChI | InChI=1S/C11H13ClFNO2/c12-8-3-9(13)5-10(4-8)14-6-11-1-2-15-7-16-11/h3-5,11,14H,1-2,6-7H2 |
| InChIKey | JYTBJEXNHSRSQG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |