About 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline
3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline (PubChem CID 104952400) has the molecular formula C11H13ClFNO2
and a molecular weight of 245.68 g/mol. Its IUPAC name is 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline.
Molecular Properties
| Compound Name | 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline |
| PubChem CID | 104952400 |
| Molecular Formula | C11H13ClFNO2 |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline |
| SMILES | Fc1cc(Cl)cc(NCC2CCOCO2)c1 |
| InChI | InChI=1S/C11H13ClFNO2/c12-8-3-9(13)5-10(4-8)14-6-11-1-2-15-7-16-11/h3-5,11,14H,1-2,6-7H2 |
| InChIKey | JYTBJEXNHSRSQG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline?
The IUPAC name of 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline (CID 104952400) is 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline.
What is the SMILES notation for 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline?
The canonical SMILES for 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline is Fc1cc(Cl)cc(NCC2CCOCO2)c1.
What is the InChIKey of 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline?
The InChIKey is JYTBJEXNHSRSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClFNO2/c12-8-3-9(13)5-10(4-8)14-6-11-1-2-15-7-16-11/h3-5,11,14H,1-2,6-7H2.
What are the key properties of 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline?
3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline has a molecular weight of 245.68 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(1,3-dioxan-4-ylmethyl)-5-fluoroaniline is sourced from PubChem (CID 104952400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).