C12H16FNO3 — CID 81093394
N-(1,3-dioxan-4-ylmethyl)-2-fluoro-5-methoxyaniline (PubChem CID 81093394) has the molecular formula C12H16FNO3 and a molecular weight of 241.26 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-2-fluoro-5-methoxyaniline.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-2-fluoro-5-methoxyaniline |
|---|---|
| PubChem CID | 81093394 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-2-fluoro-5-methoxyaniline |
| SMILES | COc1ccc(F)c(NCC2CCOCO2)c1 |
| InChI | InChI=1S/C12H16FNO3/c1-15-9-2-3-11(13)12(6-9)14-7-10-4-5-16-8-17-10/h2-3,6,10,14H,4-5,7-8H2,1H3 |
| InChIKey | HJNIJRKUQYSLDU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |