C13H19NO4 — CID 81101068
N-(1,3-dioxan-4-ylmethyl)-2,4-dimethoxyaniline (PubChem CID 81101068) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-2,4-dimethoxyaniline.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 81101068 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-2,4-dimethoxyaniline |
| SMILES | COc1ccc(NCC2CCOCO2)c(OC)c1 |
| InChI | InChI=1S/C13H19NO4/c1-15-10-3-4-12(13(7-10)16-2)14-8-11-5-6-17-9-18-11/h3-4,7,11,14H,5-6,8-9H2,1-2H3 |
| InChIKey | NDHUIEFCBDQSJN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|