C13H18ClNO3 — CID 81101301
4-chloro-N-(1,3-dioxan-4-ylmethyl)-2-methoxy-5-methylaniline (PubChem CID 81101301) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 4-chloro-N-(1,3-dioxan-4-ylmethyl)-2-methoxy-5-methylaniline.
| Compound Name | 4-chloro-N-(1,3-dioxan-4-ylmethyl)-2-methoxy-5-methylaniline |
|---|---|
| PubChem CID | 81101301 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-chloro-N-(1,3-dioxan-4-ylmethyl)-2-methoxy-5-methylaniline |
| SMILES | COc1cc(Cl)c(C)cc1NCC1CCOCO1 |
| InChI | InChI=1S/C13H18ClNO3/c1-9-5-12(13(16-2)6-11(9)14)15-7-10-3-4-17-8-18-10/h5-6,10,15H,3-4,7-8H2,1-2H3 |
| InChIKey | DZGDLZVKLJMGQX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |