C12H17NO2S — CID 104952378
N-(1,3-dioxan-4-ylmethyl)-2-methylsulfanylaniline (PubChem CID 104952378) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-2-methylsulfanylaniline.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-2-methylsulfanylaniline |
|---|---|
| PubChem CID | 104952378 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-2-methylsulfanylaniline |
| SMILES | CSc1ccccc1NCC1CCOCO1 |
| InChI | InChI=1S/C12H17NO2S/c1-16-12-5-3-2-4-11(12)13-8-10-6-7-14-9-15-10/h2-5,10,13H,6-9H2,1H3 |
| InChIKey | UHYDOEFGYGBHLO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |