C17H19NO3 — CID 81093029
N-(1,3-dioxan-4-ylmethyl)-4-phenoxyaniline (PubChem CID 81093029) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-4-phenoxyaniline.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-4-phenoxyaniline |
|---|---|
| PubChem CID | 81093029 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-4-phenoxyaniline |
| SMILES | c1ccc(Oc2ccc(NCC3CCOCO3)cc2)cc1 |
| InChI | InChI=1S/C17H19NO3/c1-2-4-15(5-3-1)21-16-8-6-14(7-9-16)18-12-17-10-11-19-13-20-17/h1-9,17-18H,10-13H2 |
| InChIKey | KWSVCLMLQJUWRQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |