C15H11Br2Cl2NO — CID 107789032
4-bromo-N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dichloroaniline (PubChem CID 107789032) has the molecular formula C15H11Br2Cl2NO and a molecular weight of 451.97 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dichloroaniline.
| Compound Name | 4-bromo-N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dichloroaniline |
|---|---|
| PubChem CID | 107789032 |
| Molecular Formula | C15H11Br2Cl2NO |
| Molecular Weight | 451.97 g/mol |
| Exact Mass | 448.86 |
| IUPAC Name | 4-bromo-N-[(5-bromo-2,3-dihydro-1-benzofuran-2-yl)methyl]-2,3-dichloroaniline |
| SMILES | Clc1c(Br)ccc(NCC2Cc3cc(Br)ccc3O2)c1Cl |
| InChI | InChI=1S/C15H11Br2Cl2NO/c16-9-1-4-13-8(5-9)6-10(21-13)7-20-12-3-2-11(17)14(18)15(12)19/h1-5,10,20H,6-7H2 |
| InChIKey | YRHJSGPYEXNHLT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.97 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|