C23H28ClN3O3S — CID 3440194
N-[(4-tert-butylcyclohexylidene)amino]-3-[(2-chlorophenyl)sulfamoyl]benzamide (PubChem CID 3440194) has the molecular formula C23H28ClN3O3S and a molecular weight of 462.02 g/mol. Its IUPAC name is N-[(4-tert-butylcyclohexylidene)amino]-3-[(2-chlorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[(4-tert-butylcyclohexylidene)amino]-3-[(2-chlorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 3440194 |
| Molecular Formula | C23H28ClN3O3S |
| Molecular Weight | 462.02 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | N-[(4-tert-butylcyclohexylidene)amino]-3-[(2-chlorophenyl)sulfamoyl]benzamide |
| SMILES | CC(C)(C)C1CCC(=NNC(=O)c2cccc(S(=O)(=O)Nc3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C23H28ClN3O3S/c1-23(2,3)17-11-13-18(14-12-17)25-26-22(28)16-7-6-8-19(15-16)31(29,30)27-21-10-5-4-9-20(21)24/h4-10,15,17,27H,11-14H2,1-3H3,(H,26,28)/b25-18- |
| InChIKey | WOECUZAKCZSTFN-BWAHOGKJSA-N |
| XLogP | 5.46 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.02 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|