C21H22N2O5S — CID 34403875
(E)-3-[4-(methylsulfamoyl)phenyl]-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylprop-2-enamide (PubChem CID 34403875) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is (E)-3-[4-(methylsulfamoyl)phenyl]-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylprop-2-enamide.
| Compound Name | (E)-3-[4-(methylsulfamoyl)phenyl]-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylprop-2-enamide |
|---|---|
| PubChem CID | 34403875 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | (E)-3-[4-(methylsulfamoyl)phenyl]-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylprop-2-enamide |
| SMILES | CNS(=O)(=O)c1ccc(/C=C/C(=O)Nc2ccc3c(c2)OC2(CCCC2)O3)cc1 |
| InChI | InChI=1S/C21H22N2O5S/c1-22-29(25,26)17-8-4-15(5-9-17)6-11-20(24)23-16-7-10-18-19(14-16)28-21(27-18)12-2-3-13-21/h4-11,14,22H,2-3,12-13H2,1H3,(H,23,24)/b11-6+ |
| InChIKey | QELVETJFEQITGH-IZZDOVSWSA-N |
| XLogP | 3.29 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|