C23H24N2O4 — CID 46604225
N-methyl-4-[(E)-3-oxo-3-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)prop-1-enyl]benzamide (PubChem CID 46604225) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-methyl-4-[(E)-3-oxo-3-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)prop-1-enyl]benzamide.
| Compound Name | N-methyl-4-[(E)-3-oxo-3-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)prop-1-enyl]benzamide |
|---|---|
| PubChem CID | 46604225 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-methyl-4-[(E)-3-oxo-3-(spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylamino)prop-1-enyl]benzamide |
| SMILES | CNC(=O)c1ccc(/C=C/C(=O)Nc2ccc3c(c2)OC2(CCCCC2)O3)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-24-22(27)17-8-5-16(6-9-17)7-12-21(26)25-18-10-11-19-20(15-18)29-23(28-19)13-3-2-4-14-23/h5-12,15H,2-4,13-14H2,1H3,(H,24,27)(H,25,26)/b12-7+ |
| InChIKey | XHSCCPZRPRUGBO-KPKJPENVSA-N |
| XLogP | 4.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|