C18H17N3O3S3 — CID 25397818
(E)-3-[4-(methylsulfamoyl)phenyl]-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)prop-2-enamide (PubChem CID 25397818) has the molecular formula C18H17N3O3S3 and a molecular weight of 419.55 g/mol. Its IUPAC name is (E)-3-[4-(methylsulfamoyl)phenyl]-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(methylsulfamoyl)phenyl]-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 25397818 |
| Molecular Formula | C18H17N3O3S3 |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | (E)-3-[4-(methylsulfamoyl)phenyl]-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)prop-2-enamide |
| SMILES | CNS(=O)(=O)c1ccc(/C=C/C(=O)Nc2ccc3nc(SC)sc3c2)cc1 |
| InChI | InChI=1S/C18H17N3O3S3/c1-19-27(23,24)14-7-3-12(4-8-14)5-10-17(22)20-13-6-9-15-16(11-13)26-18(21-15)25-2/h3-11,19H,1-2H3,(H,20,22)/b10-5+ |
| InChIKey | AYYGXUNXYCOJPI-BJMVGYQFSA-N |
| XLogP | 3.58 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|