C24H17FN2O2S2 — CID 94849717
(E)-N-[2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-3-phenylprop-2-enamide (PubChem CID 94849717) has the molecular formula C24H17FN2O2S2 and a molecular weight of 448.54 g/mol. Its IUPAC name is (E)-N-[2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 94849717 |
| Molecular Formula | C24H17FN2O2S2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | (E)-N-[2-[2-(4-fluorophenyl)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1ccc2nc(SCC(=O)c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C24H17FN2O2S2/c25-18-9-7-17(8-10-18)21(28)15-30-24-27-20-12-11-19(14-22(20)31-24)26-23(29)13-6-16-4-2-1-3-5-16/h1-14H,15H2,(H,26,29)/b13-6+ |
| InChIKey | VCWVPZNSFGLODX-AWNIVKPZSA-N |
| XLogP | 6.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|