C22H30N2O4+2 — CID 3447347
1-(furan-2-yl)-3-(4-methylphenyl)-2,3-di(morpholin-4-ium-4-yl)propan-1-one (PubChem CID 3447347) has the molecular formula C22H30N2O4+2 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-(furan-2-yl)-3-(4-methylphenyl)-2,3-di(morpholin-4-ium-4-yl)propan-1-one.
| Compound Name | 1-(furan-2-yl)-3-(4-methylphenyl)-2,3-di(morpholin-4-ium-4-yl)propan-1-one |
|---|---|
| PubChem CID | 3447347 |
| Molecular Formula | C22H30N2O4+2 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-(furan-2-yl)-3-(4-methylphenyl)-2,3-di(morpholin-4-ium-4-yl)propan-1-one |
| SMILES | Cc1ccc(C(C(C(=O)c2ccco2)[NH+]2CCOCC2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-17-4-6-18(7-5-17)20(23-8-13-26-14-9-23)21(24-10-15-27-16-11-24)22(25)19-3-2-12-28-19/h2-7,12,20-21H,8-11,13-16H2,1H3/p+2 |
| InChIKey | WIIAKJDQWGCZOG-UHFFFAOYSA-P |
| XLogP | -0.29 |
| TPSA | 57.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |