C23H31ClN2O2+2 — CID 6973428
(2R,3S)-3-(4-chlorophenyl)-1-(furan-2-yl)-2,3-di(piperidin-1-ium-1-yl)propan-1-one (PubChem CID 6973428) has the molecular formula C23H31ClN2O2+2 and a molecular weight of 402.97 g/mol. Its IUPAC name is (2R,3S)-3-(4-chlorophenyl)-1-(furan-2-yl)-2,3-di(piperidin-1-ium-1-yl)propan-1-one.
| Compound Name | (2R,3S)-3-(4-chlorophenyl)-1-(furan-2-yl)-2,3-di(piperidin-1-ium-1-yl)propan-1-one |
|---|---|
| PubChem CID | 6973428 |
| Molecular Formula | C23H31ClN2O2+2 |
| Molecular Weight | 402.97 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (2R,3S)-3-(4-chlorophenyl)-1-(furan-2-yl)-2,3-di(piperidin-1-ium-1-yl)propan-1-one |
| SMILES | O=C(c1ccco1)[C@@H]([C@H](c1ccc(Cl)cc1)[NH+]1CCCCC1)[NH+]1CCCCC1 |
| InChI | InChI=1S/C23H29ClN2O2/c24-19-11-9-18(10-12-19)21(25-13-3-1-4-14-25)22(26-15-5-2-6-16-26)23(27)20-8-7-17-28-20/h7-12,17,21-22H,1-6,13-16H2/p+2/t21-,22+/m0/s1 |
| InChIKey | ABBUBZLTHBIYDK-FCHUYYIVSA-P |
| XLogP | 2.36 |
| TPSA | 39.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.97 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |