C21H26N4O4S2 — CID 3450772
2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]sulfanyl-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide (PubChem CID 3450772) has the molecular formula C21H26N4O4S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]sulfanyl-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide.
| Compound Name | 2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]sulfanyl-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
|---|---|
| PubChem CID | 3450772 |
| Molecular Formula | C21H26N4O4S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]sulfanyl-N-(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)acetamide |
| SMILES | C=CCn1/c(=N/C(=O)CSCC(=O)N2CC(C)CC(C)C2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C21H26N4O4S2/c1-4-7-24-17-6-5-16(25(28)29)9-18(17)31-21(24)22-19(26)12-30-13-20(27)23-10-14(2)8-15(3)11-23/h4-6,9,14-15H,1,7-8,10-13H2,2-3H3/b22-21- |
| InChIKey | AKPWFOAVMVGGNG-DQRAZIAOSA-N |
| XLogP | 3.46 |
| TPSA | 97.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|