C14H18FO3P — CID 3456590
[3,3-dimethylbut-1-ynyl(methoxy)phosphoryl]-(4-fluorophenyl)methanol (PubChem CID 3456590) has the molecular formula C14H18FO3P and a molecular weight of 284.27 g/mol. Its IUPAC name is [3,3-dimethylbut-1-ynyl(methoxy)phosphoryl]-(4-fluorophenyl)methanol.
| Compound Name | [3,3-dimethylbut-1-ynyl(methoxy)phosphoryl]-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 3456590 |
| Molecular Formula | C14H18FO3P |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | [3,3-dimethylbut-1-ynyl(methoxy)phosphoryl]-(4-fluorophenyl)methanol |
| SMILES | COP(=O)(C#CC(C)(C)C)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FO3P/c1-14(2,3)9-10-19(17,18-4)13(16)11-5-7-12(15)8-6-11/h5-8,13,16H,1-4H3 |
| InChIKey | NKTJBGHVZOODSW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|