C21H20ClN5O3S — CID 3462327
N-[2-(2-chloro-4-nitroanilino)ethyl]-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 3462327) has the molecular formula C21H20ClN5O3S and a molecular weight of 457.94 g/mol. Its IUPAC name is N-[2-(2-chloro-4-nitroanilino)ethyl]-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[2-(2-chloro-4-nitroanilino)ethyl]-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3462327 |
| Molecular Formula | C21H20ClN5O3S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | N-[2-(2-chloro-4-nitroanilino)ethyl]-2-(4-methyl-6-phenylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(-c2ccccc2)nc(SCC(=O)NCCNc2ccc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C21H20ClN5O3S/c1-14-11-19(15-5-3-2-4-6-15)26-21(25-14)31-13-20(28)24-10-9-23-18-8-7-16(27(29)30)12-17(18)22/h2-8,11-12,23H,9-10,13H2,1H3,(H,24,28) |
| InChIKey | MPIGXDQXMBCDOQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|