C15H18ClN7O3S — CID 4148486
N-[3-(2-chloro-4-nitroanilino)propyl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide (PubChem CID 4148486) has the molecular formula C15H18ClN7O3S and a molecular weight of 411.88 g/mol. Its IUPAC name is N-[3-(2-chloro-4-nitroanilino)propyl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[3-(2-chloro-4-nitroanilino)propyl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4148486 |
| Molecular Formula | C15H18ClN7O3S |
| Molecular Weight | 411.88 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | N-[3-(2-chloro-4-nitroanilino)propyl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)NCCCNc2ccc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C15H18ClN7O3S/c16-10-6-9(23(25)26)2-3-11(10)19-4-1-5-20-14(24)8-27-15-21-12(17)7-13(18)22-15/h2-3,6-7,19H,1,4-5,8H2,(H,20,24)(H4,17,18,21,22) |
| InChIKey | PWMAMWNDSDVNCG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.88 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|