C13H15N3OS — CID 3471496
2-amino-5-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazol-4-one (PubChem CID 3471496) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-amino-5-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-amino-5-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 3471496 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-amino-5-[(1-cyclopropyl-2,5-dimethylpyrrol-3-yl)methylidene]-1,3-thiazol-4-one |
| SMILES | Cc1cc(C=C2SC(N)=NC2=O)c(C)n1C1CC1 |
| InChI | InChI=1S/C13H15N3OS/c1-7-5-9(8(2)16(7)10-3-4-10)6-11-12(17)15-13(14)18-11/h5-6,10H,3-4H2,1-2H3,(H2,14,15,17) |
| InChIKey | NQGBYJDXWZGFRJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|