C8H7N5O4 — CID 3485343
2-methoxy-4-nitro-6-(2H-tetrazol-5-yl)phenol (PubChem CID 3485343) has the molecular formula C8H7N5O4 and a molecular weight of 237.18 g/mol. Its IUPAC name is 2-methoxy-4-nitro-6-(2H-tetrazol-5-yl)phenol.
| Compound Name | 2-methoxy-4-nitro-6-(2H-tetrazol-5-yl)phenol |
|---|---|
| PubChem CID | 3485343 |
| Molecular Formula | C8H7N5O4 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-methoxy-4-nitro-6-(2H-tetrazol-5-yl)phenol |
| SMILES | COc1cc([N+](=O)[O-])cc(-c2nn[nH]n2)c1O |
| InChI | InChI=1S/C8H7N5O4/c1-17-6-3-4(13(15)16)2-5(7(6)14)8-9-11-12-10-8/h2-3,14H,1H3,(H,9,10,11,12) |
| InChIKey | QGSDWYYWVGDZDH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 127.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|