C27H29F3N2O2 — CID 3488381
2-(4-tert-butylphenyl)-N-methoxy-6-methyl-1-[4-(trifluoromethoxy)phenyl]-6,7-dihydro-5H-indol-4-imine (PubChem CID 3488381) has the molecular formula C27H29F3N2O2 and a molecular weight of 470.54 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-methoxy-6-methyl-1-[4-(trifluoromethoxy)phenyl]-6,7-dihydro-5H-indol-4-imine.
| Compound Name | 2-(4-tert-butylphenyl)-N-methoxy-6-methyl-1-[4-(trifluoromethoxy)phenyl]-6,7-dihydro-5H-indol-4-imine |
|---|---|
| PubChem CID | 3488381 |
| Molecular Formula | C27H29F3N2O2 |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-methoxy-6-methyl-1-[4-(trifluoromethoxy)phenyl]-6,7-dihydro-5H-indol-4-imine |
| SMILES | CON=C1CC(C)Cc2c1cc(-c1ccc(C(C)(C)C)cc1)n2-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C27H29F3N2O2/c1-17-14-23(31-33-5)22-16-24(18-6-8-19(9-7-18)26(2,3)4)32(25(22)15-17)20-10-12-21(13-11-20)34-27(28,29)30/h6-13,16-17H,14-15H2,1-5H3 |
| InChIKey | LUVGGLXPGYLWAX-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 35.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|