About [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate
[4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate (PubChem CID 3510089) has the molecular formula C19H12ClN3O5
and a molecular weight of 397.77 g/mol. Its IUPAC name is [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate |
| PubChem CID | 3510089 |
| Molecular Formula | C19H12ClN3O5 |
| Molecular Weight | 397.77 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate |
| SMILES | O=C(Oc1ccc(/C=N/c2cc(Cl)c([N+](=O)[O-])cc2O)cc1)c1cccnc1 |
| InChI | InChI=1S/C19H12ClN3O5/c20-15-8-16(18(24)9-17(15)23(26)27)22-10-12-3-5-14(6-4-12)28-19(25)13-2-1-7-21-11-13/h1-11,24H/b22-10+ |
| InChIKey | OLUHQNLHLANULA-LSHDLFTRSA-N |
| XLogP | 4.32 |
| TPSA | 114.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.77 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate?
The IUPAC name of [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate (CID 3510089) is [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate.
What is the SMILES notation for [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate?
The canonical SMILES for [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate is O=C(Oc1ccc(/C=N/c2cc(Cl)c([N+](=O)[O-])cc2O)cc1)c1cccnc1.
What is the InChIKey of [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate?
The InChIKey is OLUHQNLHLANULA-LSHDLFTRSA-N. The full InChI is InChI=1S/C19H12ClN3O5/c20-15-8-16(18(24)9-17(15)23(26)27)22-10-12-3-5-14(6-4-12)28-19(25)13-2-1-7-21-11-13/h1-11,24H/b22-10+.
What are the key properties of [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate?
[4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate has a molecular weight of 397.77 g/mol, XLogP of 4.32, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5-chloro-2-hydroxy-4-nitrophenyl)iminomethyl]phenyl] pyridine-3-carboxylate is sourced from PubChem (CID 3510089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).