C23H19Cl3N2O2 — CID 3512109
N,N-dibenzyl-2-[(2,2,2-trichloroacetyl)amino]benzamide (PubChem CID 3512109) has the molecular formula C23H19Cl3N2O2 and a molecular weight of 461.78 g/mol. Its IUPAC name is N,N-dibenzyl-2-[(2,2,2-trichloroacetyl)amino]benzamide.
| Compound Name | N,N-dibenzyl-2-[(2,2,2-trichloroacetyl)amino]benzamide |
|---|---|
| PubChem CID | 3512109 |
| Molecular Formula | C23H19Cl3N2O2 |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | N,N-dibenzyl-2-[(2,2,2-trichloroacetyl)amino]benzamide |
| SMILES | O=C(c1ccccc1NC(=O)C(Cl)(Cl)Cl)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H19Cl3N2O2/c24-23(25,26)22(30)27-20-14-8-7-13-19(20)21(29)28(15-17-9-3-1-4-10-17)16-18-11-5-2-6-12-18/h1-14H,15-16H2,(H,27,30) |
| InChIKey | AQEKMLDVSPXSJX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|