C23H24N2O6S — CID 35143678
butyl 4-[[3-(furan-2-ylmethylsulfamoyl)benzoyl]amino]benzoate (PubChem CID 35143678) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is butyl 4-[[3-(furan-2-ylmethylsulfamoyl)benzoyl]amino]benzoate.
| Compound Name | butyl 4-[[3-(furan-2-ylmethylsulfamoyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 35143678 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | butyl 4-[[3-(furan-2-ylmethylsulfamoyl)benzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2cccc(S(=O)(=O)NCc3ccco3)c2)cc1 |
| InChI | InChI=1S/C23H24N2O6S/c1-2-3-13-31-23(27)17-9-11-19(12-10-17)25-22(26)18-6-4-8-21(15-18)32(28,29)24-16-20-7-5-14-30-20/h4-12,14-15,24H,2-3,13,16H2,1H3,(H,25,26) |
| InChIKey | WCYDCDFGSWUAGF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|