C19H22F3N3O3 — CID 35169844
1-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide (PubChem CID 35169844) has the molecular formula C19H22F3N3O3 and a molecular weight of 397.40 g/mol. Its IUPAC name is 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide.
| Compound Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 35169844 |
| Molecular Formula | C19H22F3N3O3 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-(2,2,2-trifluoroethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCN(CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C19H22F3N3O3/c20-19(21,22)12-23-16(26)13-6-10-24(11-7-13)8-3-9-25-17(27)14-4-1-2-5-15(14)18(25)28/h1-2,4-5,13H,3,6-12H2,(H,23,26) |
| InChIKey | UJZSHAYHEKGZFO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|