C16H17N6O2+ — CID 3519614
4-[2-[cyclopropyl(phenyl)methylidene]hydrazinyl]-1,3-dimethyl-2,6-dioxopyrimidine-5-diazonium (PubChem CID 3519614) has the molecular formula C16H17N6O2+ and a molecular weight of 325.35 g/mol. Its IUPAC name is 4-[2-[cyclopropyl(phenyl)methylidene]hydrazinyl]-1,3-dimethyl-2,6-dioxopyrimidine-5-diazonium.
| Compound Name | 4-[2-[cyclopropyl(phenyl)methylidene]hydrazinyl]-1,3-dimethyl-2,6-dioxopyrimidine-5-diazonium |
|---|---|
| PubChem CID | 3519614 |
| Molecular Formula | C16H17N6O2+ |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-[2-[cyclopropyl(phenyl)methylidene]hydrazinyl]-1,3-dimethyl-2,6-dioxopyrimidine-5-diazonium |
| SMILES | Cn1c(NN=C(c2ccccc2)C2CC2)c([N+]#N)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H16N6O2/c1-21-14(13(18-17)15(23)22(2)16(21)24)20-19-12(11-8-9-11)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3/p+1 |
| InChIKey | ALIFADAZEXSZNG-UHFFFAOYSA-O |
| XLogP | 1.79 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|