C12H24N2O4S — CID 3523496
methyl 2-(3-ethoxypropylcarbamoylamino)-4-methylsulfanylbutanoate (PubChem CID 3523496) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is methyl 2-(3-ethoxypropylcarbamoylamino)-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-(3-ethoxypropylcarbamoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3523496 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | methyl 2-(3-ethoxypropylcarbamoylamino)-4-methylsulfanylbutanoate |
| SMILES | CCOCCCNC(=O)NC(CCSC)C(=O)OC |
| InChI | InChI=1S/C12H24N2O4S/c1-4-18-8-5-7-13-12(16)14-10(6-9-19-3)11(15)17-2/h10H,4-9H2,1-3H3,(H2,13,14,16) |
| InChIKey | LJPYQWRXVJHROM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|