C27H22N4O — CID 3526292
N-(1H-benzo[g]indol-3-ylmethylideneamino)-4-(benzylamino)benzamide (PubChem CID 3526292) has the molecular formula C27H22N4O and a molecular weight of 418.50 g/mol. Its IUPAC name is N-(1H-benzo[g]indol-3-ylmethylideneamino)-4-(benzylamino)benzamide.
| Compound Name | N-(1H-benzo[g]indol-3-ylmethylideneamino)-4-(benzylamino)benzamide |
|---|---|
| PubChem CID | 3526292 |
| Molecular Formula | C27H22N4O |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-(1H-benzo[g]indol-3-ylmethylideneamino)-4-(benzylamino)benzamide |
| SMILES | O=C(NN=Cc1c[nH]c2c1ccc1ccccc12)c1ccc(NCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N4O/c32-27(21-10-13-23(14-11-21)28-16-19-6-2-1-3-7-19)31-30-18-22-17-29-26-24-9-5-4-8-20(24)12-15-25(22)26/h1-15,17-18,28-29H,16H2,(H,31,32) |
| InChIKey | IAYXCKKYSKASTB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|